C15H13N5O3 — CID 155446319
4-[amino-[(Z)-2-amino-2-(4-cyano-2-pyridinyl)ethenyl]amino]-2-hydroxybenzoic acid (PubChem CID 155446319) has the molecular formula C15H13N5O3 and a molecular weight of 311.30 g/mol. Its IUPAC name is 4-[amino-[(Z)-2-amino-2-(4-cyano-2-pyridinyl)ethenyl]amino]-2-hydroxybenzoic acid.
| Compound Name | 4-[amino-[(Z)-2-amino-2-(4-cyano-2-pyridinyl)ethenyl]amino]-2-hydroxybenzoic acid |
|---|---|
| PubChem CID | 155446319 |
| Molecular Formula | C15H13N5O3 |
| Molecular Weight | 311.30 g/mol |
| Exact Mass | 311.10 |
| IUPAC Name | 4-[amino-[(Z)-2-amino-2-(4-cyano-2-pyridinyl)ethenyl]amino]-2-hydroxybenzoic acid |
| SMILES | N#Cc1ccnc(/C(N)=C/N(N)c2ccc(C(=O)O)c(O)c2)c1 |
| InChI | InChI=1S/C15H13N5O3/c16-7-9-3-4-19-13(5-9)12(17)8-20(18)10-1-2-11(15(22)23)14(21)6-10/h1-6,8,21H,17-18H2,(H,22,23)/b12-8- |
| InChIKey | VMKWTQBQDUABRN-WQLSENKSSA-N |
| XLogP | 0.99 |
| TPSA | 149.49 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.30 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|