C16H14N4O3 — CID 139314555
4-[amino-[(Z)-2-amino-2-(4-ethynyl-2-pyridinyl)ethenyl]amino]-2-hydroxybenzoic acid (PubChem CID 139314555) has the molecular formula C16H14N4O3 and a molecular weight of 310.31 g/mol. Its IUPAC name is 4-[amino-[(Z)-2-amino-2-(4-ethynyl-2-pyridinyl)ethenyl]amino]-2-hydroxybenzoic acid.
| Compound Name | 4-[amino-[(Z)-2-amino-2-(4-ethynyl-2-pyridinyl)ethenyl]amino]-2-hydroxybenzoic acid |
|---|---|
| PubChem CID | 139314555 |
| Molecular Formula | C16H14N4O3 |
| Molecular Weight | 310.31 g/mol |
| Exact Mass | 310.11 |
| IUPAC Name | 4-[amino-[(Z)-2-amino-2-(4-ethynyl-2-pyridinyl)ethenyl]amino]-2-hydroxybenzoic acid |
| SMILES | C#Cc1ccnc(/C(N)=C/N(N)c2ccc(C(=O)O)c(O)c2)c1 |
| InChI | InChI=1S/C16H14N4O3/c1-2-10-5-6-19-14(7-10)13(17)9-20(18)11-3-4-12(16(22)23)15(21)8-11/h1,3-9,21H,17-18H2,(H,22,23)/b13-9- |
| InChIKey | KIHGPWINFZXMJW-LCYFTJDESA-N |
| XLogP | 1.10 |
| TPSA | 125.70 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.31 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|