C13H14ClN3O4S — CID 155452036
4-chloro-2-(furan-2-ylmethylamino)-5-(methylsulfamoyl)benzamide (PubChem CID 155452036) has the molecular formula C13H14ClN3O4S and a molecular weight of 343.79 g/mol. Its IUPAC name is 4-chloro-2-(furan-2-ylmethylamino)-5-(methylsulfamoyl)benzamide.
| Compound Name | 4-chloro-2-(furan-2-ylmethylamino)-5-(methylsulfamoyl)benzamide |
|---|---|
| PubChem CID | 155452036 |
| Molecular Formula | C13H14ClN3O4S |
| Molecular Weight | 343.79 g/mol |
| Exact Mass | 343.04 |
| IUPAC Name | 4-chloro-2-(furan-2-ylmethylamino)-5-(methylsulfamoyl)benzamide |
| SMILES | CNS(=O)(=O)c1cc(C(N)=O)c(NCc2ccco2)cc1Cl |
| InChI | InChI=1S/C13H14ClN3O4S/c1-16-22(19,20)12-5-9(13(15)18)11(6-10(12)14)17-7-8-3-2-4-21-8/h2-6,16-17H,7H2,1H3,(H2,15,18) |
| InChIKey | LCBOBHDHNFBNLQ-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 114.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.79 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |