C12H11ClN2O5S — CID 3440
4-chloro-2-(furan-2-ylmethylamino)-5-sulfamoylbenzoic acid (PubChem CID 3440) has the molecular formula C12H11ClN2O5S and a molecular weight of 330.75 g/mol. Its IUPAC name is 4-chloro-2-(furan-2-ylmethylamino)-5-sulfamoylbenzoic acid.
| Compound Name | 4-chloro-2-(furan-2-ylmethylamino)-5-sulfamoylbenzoic acid |
|---|---|
| PubChem CID | 3440 |
| Molecular Formula | C12H11ClN2O5S |
| Molecular Weight | 330.75 g/mol |
| Exact Mass | 330.01 |
| IUPAC Name | 4-chloro-2-(furan-2-ylmethylamino)-5-sulfamoylbenzoic acid |
| SMILES | NS(=O)(=O)c1cc(C(=O)O)c(NCc2ccco2)cc1Cl |
| InChI | InChI=1S/C12H11ClN2O5S/c13-9-5-10(15-6-7-2-1-3-20-7)8(12(16)17)4-11(9)21(14,18)19/h1-5,15H,6H2,(H,16,17)(H2,14,18,19) |
| InChIKey | ZZUFCTLCJUWOSV-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 122.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.75 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |