C12H10ClN2NaO5S — CID 23673593
Sodium furosemide (PubChem CID 23673593) has the molecular formula C12H10ClN2NaO5S and a molecular weight of 352.73 g/mol. Its IUPAC name is sodium 4-chloro-2-(furan-2-ylmethylamino)-5-sulfamoylbenzoate.
| Compound Name | Sodium furosemide |
|---|---|
| PubChem CID | 23673593 |
| Molecular Formula | C12H10ClN2NaO5S |
| Molecular Weight | 352.73 g/mol |
| Exact Mass | 351.99 |
| IUPAC Name | sodium 4-chloro-2-(furan-2-ylmethylamino)-5-sulfamoylbenzoate |
| SMILES | C1=COC(=C1)CNC2=CC(=C(C=C2C(=O)[O-])S(=O)(=O)N)Cl.[Na+] |
| InChI | InChI=1S/C12H11ClN2O5S.Na/c13-9-5-10(15-6-7-2-1-3-20-7)8(12(16)17)4-11(9)21(14,18)19;/h1-5,15H,6H2,(H,16,17)(H2,14,18,19);/q;+1/p-1 |
| InChIKey | DLFCAVBMDSKMEY-UHFFFAOYSA-M |
| XLogP | — |
| TPSA | 134.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | 486 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |