C14H16ClN3O4S — CID 155451989
4-chloro-2-(furan-2-ylmethylamino)-N-methyl-5-(methylsulfamoyl)benzamide (PubChem CID 155451989) has the molecular formula C14H16ClN3O4S and a molecular weight of 357.82 g/mol. Its IUPAC name is 4-chloro-2-(furan-2-ylmethylamino)-N-methyl-5-(methylsulfamoyl)benzamide.
| Compound Name | 4-chloro-2-(furan-2-ylmethylamino)-N-methyl-5-(methylsulfamoyl)benzamide |
|---|---|
| PubChem CID | 155451989 |
| Molecular Formula | C14H16ClN3O4S |
| Molecular Weight | 357.82 g/mol |
| Exact Mass | 357.06 |
| IUPAC Name | 4-chloro-2-(furan-2-ylmethylamino)-N-methyl-5-(methylsulfamoyl)benzamide |
| SMILES | CNC(=O)c1cc(S(=O)(=O)NC)c(Cl)cc1NCc1ccco1 |
| InChI | InChI=1S/C14H16ClN3O4S/c1-16-14(19)10-6-13(23(20,21)17-2)11(15)7-12(10)18-8-9-4-3-5-22-9/h3-7,17-18H,8H2,1-2H3,(H,16,19) |
| InChIKey | QPXPVQXFSWFIDM-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 100.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.82 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |