C16H20Cl2N4O — CID 155454976
[(3aS,6aR)-2-(2,5-dichloropyrimidin-4-yl)-3a,6a-dimethyl-1,3,4,6-tetrahydropyrrolo[3,4-c]pyrrol-5-yl]-cyclopropylmethanone (PubChem CID 155454976) has the molecular formula C16H20Cl2N4O and a molecular weight of 355.27 g/mol. Its IUPAC name is [(3aS,6aR)-2-(2,5-dichloropyrimidin-4-yl)-3a,6a-dimethyl-1,3,4,6-tetrahydropyrrolo[3,4-c]pyrrol-5-yl]-cyclopropylmethanone.
| Compound Name | [(3aS,6aR)-2-(2,5-dichloropyrimidin-4-yl)-3a,6a-dimethyl-1,3,4,6-tetrahydropyrrolo[3,4-c]pyrrol-5-yl]-cyclopropylmethanone |
|---|---|
| PubChem CID | 155454976 |
| Molecular Formula | C16H20Cl2N4O |
| Molecular Weight | 355.27 g/mol |
| Exact Mass | 354.10 |
| IUPAC Name | [(3aS,6aR)-2-(2,5-dichloropyrimidin-4-yl)-3a,6a-dimethyl-1,3,4,6-tetrahydropyrrolo[3,4-c]pyrrol-5-yl]-cyclopropylmethanone |
| SMILES | C[C@@]12CN(C(=O)C3CC3)C[C@]1(C)CN(c1nc(Cl)ncc1Cl)C2 |
| InChI | InChI=1S/C16H20Cl2N4O/c1-15-6-21(12-11(17)5-19-14(18)20-12)7-16(15,2)9-22(8-15)13(23)10-3-4-10/h5,10H,3-4,6-9H2,1-2H3/t15-,16+ |
| InChIKey | XEKPMUSGROGTIY-IYBDPMFKSA-N |
| XLogP | 2.87 |
| TPSA | 49.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.27 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |