C12H9Cl2N3 — CID 79632513
2-(2,5-dichloropyrimidin-4-yl)-1,3-dihydroisoindole (PubChem CID 79632513) has the molecular formula C12H9Cl2N3 and a molecular weight of 266.13 g/mol. Its IUPAC name is 2-(2,5-dichloropyrimidin-4-yl)-1,3-dihydroisoindole.
| Compound Name | 2-(2,5-dichloropyrimidin-4-yl)-1,3-dihydroisoindole |
|---|---|
| PubChem CID | 79632513 |
| Molecular Formula | C12H9Cl2N3 |
| Molecular Weight | 266.13 g/mol |
| Exact Mass | 265.02 |
| IUPAC Name | 2-(2,5-dichloropyrimidin-4-yl)-1,3-dihydroisoindole |
| SMILES | Clc1ncc(Cl)c(N2Cc3ccccc3C2)n1 |
| InChI | InChI=1S/C12H9Cl2N3/c13-10-5-15-12(14)16-11(10)17-6-8-3-1-2-4-9(8)7-17/h1-5H,6-7H2 |
| InChIKey | HWBJQFDXHUZEFB-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.13 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |