C13H10Cl2N4O2S — CID 167014276
3-(2,5-dichloropyrimidin-4-yl)-2λ6-thia-1,3-diazatricyclo[6.3.1.04,12]dodeca-4,6,8(12)-triene 2,2-dioxide (PubChem CID 167014276) has the molecular formula C13H10Cl2N4O2S and a molecular weight of 357.22 g/mol. Its IUPAC name is 3-(2,5-dichloropyrimidin-4-yl)-2λ6-thia-1,3-diazatricyclo[6.3.1.04,12]dodeca-4,6,8(12)-triene 2,2-dioxide.
| Compound Name | 3-(2,5-dichloropyrimidin-4-yl)-2λ6-thia-1,3-diazatricyclo[6.3.1.04,12]dodeca-4,6,8(12)-triene 2,2-dioxide |
|---|---|
| PubChem CID | 167014276 |
| Molecular Formula | C13H10Cl2N4O2S |
| Molecular Weight | 357.22 g/mol |
| Exact Mass | 355.99 |
| IUPAC Name | 3-(2,5-dichloropyrimidin-4-yl)-2λ6-thia-1,3-diazatricyclo[6.3.1.04,12]dodeca-4,6,8(12)-triene 2,2-dioxide |
| SMILES | O=S1(=O)N2CCCc3cccc(c32)N1c1nc(Cl)ncc1Cl |
| InChI | InChI=1S/C13H10Cl2N4O2S/c14-9-7-16-13(15)17-12(9)19-10-5-1-3-8-4-2-6-18(11(8)10)22(19,20)21/h1,3,5,7H,2,4,6H2 |
| InChIKey | AQZZNGVKLYVBQF-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 66.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.22 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |