C11H7Cl2N5 — CID 130205746
1-(2,5-dichloropyrimidin-4-yl)indazol-3-amine (PubChem CID 130205746) has the molecular formula C11H7Cl2N5 and a molecular weight of 280.12 g/mol. Its IUPAC name is 1-(2,5-dichloropyrimidin-4-yl)indazol-3-amine.
| Compound Name | 1-(2,5-dichloropyrimidin-4-yl)indazol-3-amine |
|---|---|
| PubChem CID | 130205746 |
| Molecular Formula | C11H7Cl2N5 |
| Molecular Weight | 280.12 g/mol |
| Exact Mass | 279.01 |
| IUPAC Name | 1-(2,5-dichloropyrimidin-4-yl)indazol-3-amine |
| SMILES | Nc1nn(-c2nc(Cl)ncc2Cl)c2ccccc12 |
| InChI | InChI=1S/C11H7Cl2N5/c12-7-5-15-11(13)16-10(7)18-8-4-2-1-3-6(8)9(14)17-18/h1-5H,(H2,14,17) |
| InChIKey | CDWMUDVUOOUBKA-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 69.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.12 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |