C13H6Cl2N4 — CID 171524604
1-(2,5-dichloropyrimidin-4-yl)indole-4-carbonitrile (PubChem CID 171524604) has the molecular formula C13H6Cl2N4 and a molecular weight of 289.13 g/mol. Its IUPAC name is 1-(2,5-dichloropyrimidin-4-yl)indole-4-carbonitrile.
| Compound Name | 1-(2,5-dichloropyrimidin-4-yl)indole-4-carbonitrile |
|---|---|
| PubChem CID | 171524604 |
| Molecular Formula | C13H6Cl2N4 |
| Molecular Weight | 289.13 g/mol |
| Exact Mass | 288.00 |
| IUPAC Name | 1-(2,5-dichloropyrimidin-4-yl)indole-4-carbonitrile |
| SMILES | N#Cc1cccc2c1ccn2-c1nc(Cl)ncc1Cl |
| InChI | InChI=1S/C13H6Cl2N4/c14-10-7-17-13(15)18-12(10)19-5-4-9-8(6-16)2-1-3-11(9)19/h1-5,7H |
| InChIKey | LBSWFIDIIRMBRJ-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 54.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.13 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |