C10H11Cl2N3O — CID 172608340
7-(2,5-dichloropyrimidin-4-yl)-4-oxa-7-azaspiro[2.5]octane (PubChem CID 172608340) has the molecular formula C10H11Cl2N3O and a molecular weight of 260.12 g/mol. Its IUPAC name is 7-(2,5-dichloropyrimidin-4-yl)-4-oxa-7-azaspiro[2.5]octane.
| Compound Name | 7-(2,5-dichloropyrimidin-4-yl)-4-oxa-7-azaspiro[2.5]octane |
|---|---|
| PubChem CID | 172608340 |
| Molecular Formula | C10H11Cl2N3O |
| Molecular Weight | 260.12 g/mol |
| Exact Mass | 259.03 |
| IUPAC Name | 7-(2,5-dichloropyrimidin-4-yl)-4-oxa-7-azaspiro[2.5]octane |
| SMILES | Clc1ncc(Cl)c(N2CCOC3(CC3)C2)n1 |
| InChI | InChI=1S/C10H11Cl2N3O/c11-7-5-13-9(12)14-8(7)15-3-4-16-10(6-15)1-2-10/h5H,1-4,6H2 |
| InChIKey | PVMAMGZXFPCKNF-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 38.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.12 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |