About (6S)-7-(2,5-dichloropyrimidin-4-yl)-6-methyl-4-oxa-7-azaspiro[2.5]octane
(6S)-7-(2,5-dichloropyrimidin-4-yl)-6-methyl-4-oxa-7-azaspiro[2.5]octane (PubChem CID 172608426) has the molecular formula C11H13Cl2N3O
and a molecular weight of 274.15 g/mol. Its IUPAC name is (6S)-7-(2,5-dichloropyrimidin-4-yl)-6-methyl-4-oxa-7-azaspiro[2.5]octane.
Molecular Properties
| Compound Name | (6S)-7-(2,5-dichloropyrimidin-4-yl)-6-methyl-4-oxa-7-azaspiro[2.5]octane |
| PubChem CID | 172608426 |
| Molecular Formula | C11H13Cl2N3O |
| Molecular Weight | 274.15 g/mol |
| Exact Mass | 273.04 |
| IUPAC Name | (6S)-7-(2,5-dichloropyrimidin-4-yl)-6-methyl-4-oxa-7-azaspiro[2.5]octane |
| SMILES | C[C@H]1COC2(CC2)CN1c1nc(Cl)ncc1Cl |
| InChI | InChI=1S/C11H13Cl2N3O/c1-7-5-17-11(2-3-11)6-16(7)9-8(12)4-14-10(13)15-9/h4,7H,2-3,5-6H2,1H3/t7-/m0/s1 |
| InChIKey | JHVFADYNSAONMM-ZETCQYMHSA-N |
| XLogP | 2.54 |
| TPSA | 38.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.15 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (6S)-7-(2,5-dichloropyrimidin-4-yl)-6-methyl-4-oxa-7-azaspiro[2.5]octane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6S)-7-(2,5-dichloropyrimidin-4-yl)-6-methyl-4-oxa-7-azaspiro[2.5]octane?
The IUPAC name of (6S)-7-(2,5-dichloropyrimidin-4-yl)-6-methyl-4-oxa-7-azaspiro[2.5]octane (CID 172608426) is (6S)-7-(2,5-dichloropyrimidin-4-yl)-6-methyl-4-oxa-7-azaspiro[2.5]octane.
What is the SMILES notation for (6S)-7-(2,5-dichloropyrimidin-4-yl)-6-methyl-4-oxa-7-azaspiro[2.5]octane?
The canonical SMILES for (6S)-7-(2,5-dichloropyrimidin-4-yl)-6-methyl-4-oxa-7-azaspiro[2.5]octane is C[C@H]1COC2(CC2)CN1c1nc(Cl)ncc1Cl.
What is the InChIKey of (6S)-7-(2,5-dichloropyrimidin-4-yl)-6-methyl-4-oxa-7-azaspiro[2.5]octane?
The InChIKey is JHVFADYNSAONMM-ZETCQYMHSA-N. The full InChI is InChI=1S/C11H13Cl2N3O/c1-7-5-17-11(2-3-11)6-16(7)9-8(12)4-14-10(13)15-9/h4,7H,2-3,5-6H2,1H3/t7-/m0/s1.
What are the key properties of (6S)-7-(2,5-dichloropyrimidin-4-yl)-6-methyl-4-oxa-7-azaspiro[2.5]octane?
(6S)-7-(2,5-dichloropyrimidin-4-yl)-6-methyl-4-oxa-7-azaspiro[2.5]octane has a molecular weight of 274.15 g/mol, XLogP of 2.54, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (6S)-7-(2,5-dichloropyrimidin-4-yl)-6-methyl-4-oxa-7-azaspiro[2.5]octane is sourced from PubChem (CID 172608426), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).