C24H39N5O9S4 — CID 155459987
2-[(4R,7S,10R,15R,18S,21R)-4,21-diacetyl-15-amino-7-[(1R)-1-hydroxyethyl]-10-(methylamino)-6,9,16,19-tetraoxo-1,2,12,13-tetrathia-5,8,17-triazacyclodocos-18-yl]acetic acid (PubChem CID 155459987) has the molecular formula C24H39N5O9S4 and a molecular weight of 669.87 g/mol. Its IUPAC name is 2-[(4R,7S,10R,15R,18S,21R)-4,21-diacetyl-15-amino-7-[(1R)-1-hydroxyethyl]-10-(methylamino)-6,9,16,19-tetraoxo-1,2,12,13-tetrathia-5,8,17-triazacyclodocos-18-yl]acetic acid.
| Compound Name | 2-[(4R,7S,10R,15R,18S,21R)-4,21-diacetyl-15-amino-7-[(1R)-1-hydroxyethyl]-10-(methylamino)-6,9,16,19-tetraoxo-1,2,12,13-tetrathia-5,8,17-triazacyclodocos-18-yl]acetic acid |
|---|---|
| PubChem CID | 155459987 |
| Molecular Formula | C24H39N5O9S4 |
| Molecular Weight | 669.87 g/mol |
| Exact Mass | 669.16 |
| IUPAC Name | 2-[(4R,7S,10R,15R,18S,21R)-4,21-diacetyl-15-amino-7-[(1R)-1-hydroxyethyl]-10-(methylamino)-6,9,16,19-tetraoxo-1,2,12,13-tetrathia-5,8,17-triazacyclodocos-18-yl]acetic acid |
| SMILES | CN[C@H]1CSSC[C@H](N)C(=O)N[C@@H](CC(=O)O)C(=O)C[C@H](C(C)=O)CSSC[C@@H](C(C)=O)NC(=O)[C@H]([C@@H](C)O)NC1=O |
| InChI | InChI=1S/C24H39N5O9S4/c1-11(30)14-5-19(33)16(6-20(34)35)27-22(36)15(25)8-40-42-10-18(26-4)23(37)29-21(13(3)32)24(38)28-17(12(2)31)9-41-39-7-14/h13-18,21,26,32H,5-10,25H2,1-4H3,(H,27,36)(H,28,38)(H,29,37)(H,34,35)/t13-,14+,15+,16+,17+,18+,21+/m1/s1 |
| InChIKey | SLQZKCHCFYGJFB-LCSOQEQTSA-N |
| XLogP | -1.26 |
| TPSA | 234.09 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 669.87 |
| LogP ≤ 5 | -1.26 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|