About 4-acetyl-7-(methylamino)-1,2,5-dithiazocan-6-one
4-acetyl-7-(methylamino)-1,2,5-dithiazocan-6-one (PubChem CID 59105017) has the molecular formula C8H14N2O2S2
and a molecular weight of 234.35 g/mol. Its IUPAC name is 4-acetyl-7-(methylamino)-1,2,5-dithiazocan-6-one.
Molecular Properties
| Compound Name | 4-acetyl-7-(methylamino)-1,2,5-dithiazocan-6-one |
| PubChem CID | 59105017 |
| Molecular Formula | C8H14N2O2S2 |
| Molecular Weight | 234.35 g/mol |
| Exact Mass | 234.05 |
| IUPAC Name | 4-acetyl-7-(methylamino)-1,2,5-dithiazocan-6-one |
| SMILES | CNC1CSSCC(C(C)=O)NC1=O |
| InChI | InChI=1S/C8H14N2O2S2/c1-5(11)6-3-13-14-4-7(9-2)8(12)10-6/h6-7,9H,3-4H2,1-2H3,(H,10,12) |
| InChIKey | AJESLDKPSYRIPP-UHFFFAOYSA-N |
| XLogP | 0.04 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.35 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|
Analyze 4-acetyl-7-(methylamino)-1,2,5-dithiazocan-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-acetyl-7-(methylamino)-1,2,5-dithiazocan-6-one?
The IUPAC name of 4-acetyl-7-(methylamino)-1,2,5-dithiazocan-6-one (CID 59105017) is 4-acetyl-7-(methylamino)-1,2,5-dithiazocan-6-one.
What is the SMILES notation for 4-acetyl-7-(methylamino)-1,2,5-dithiazocan-6-one?
The canonical SMILES for 4-acetyl-7-(methylamino)-1,2,5-dithiazocan-6-one is CNC1CSSCC(C(C)=O)NC1=O.
What is the InChIKey of 4-acetyl-7-(methylamino)-1,2,5-dithiazocan-6-one?
The InChIKey is AJESLDKPSYRIPP-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14N2O2S2/c1-5(11)6-3-13-14-4-7(9-2)8(12)10-6/h6-7,9H,3-4H2,1-2H3,(H,10,12).
What are the key properties of 4-acetyl-7-(methylamino)-1,2,5-dithiazocan-6-one?
4-acetyl-7-(methylamino)-1,2,5-dithiazocan-6-one has a molecular weight of 234.35 g/mol, XLogP of 0.04, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-acetyl-7-(methylamino)-1,2,5-dithiazocan-6-one is sourced from PubChem (CID 59105017), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).