C8H14N2O2S2 — CID 59105017
4-acetyl-7-(methylamino)-1,2,5-dithiazocan-6-one (PubChem CID 59105017) has the molecular formula C8H14N2O2S2 and a molecular weight of 234.35 g/mol. Its IUPAC name is 4-acetyl-7-(methylamino)-1,2,5-dithiazocan-6-one.
| Compound Name | 4-acetyl-7-(methylamino)-1,2,5-dithiazocan-6-one |
|---|---|
| PubChem CID | 59105017 |
| Molecular Formula | C8H14N2O2S2 |
| Molecular Weight | 234.35 g/mol |
| Exact Mass | 234.05 |
| IUPAC Name | 4-acetyl-7-(methylamino)-1,2,5-dithiazocan-6-one |
| SMILES | CNC1CSSCC(C(C)=O)NC1=O |
| InChI | InChI=1S/C8H14N2O2S2/c1-5(11)6-3-13-14-4-7(9-2)8(12)10-6/h6-7,9H,3-4H2,1-2H3,(H,10,12) |
| InChIKey | AJESLDKPSYRIPP-UHFFFAOYSA-N |
| XLogP | 0.04 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.35 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|