C21H27F2NO — CID 155461686
N-(2-ethylhexyl)-2,5-difluoro-N-(3-methoxyphenyl)aniline (PubChem CID 155461686) has the molecular formula C21H27F2NO and a molecular weight of 347.45 g/mol. Its IUPAC name is N-(2-ethylhexyl)-2,5-difluoro-N-(3-methoxyphenyl)aniline.
| Compound Name | N-(2-ethylhexyl)-2,5-difluoro-N-(3-methoxyphenyl)aniline |
|---|---|
| PubChem CID | 155461686 |
| Molecular Formula | C21H27F2NO |
| Molecular Weight | 347.45 g/mol |
| Exact Mass | 347.21 |
| IUPAC Name | N-(2-ethylhexyl)-2,5-difluoro-N-(3-methoxyphenyl)aniline |
| SMILES | CCCCC(CC)CN(c1cccc(OC)c1)c1cc(F)ccc1F |
| InChI | InChI=1S/C21H27F2NO/c1-4-6-8-16(5-2)15-24(18-9-7-10-19(14-18)25-3)21-13-17(22)11-12-20(21)23/h7,9-14,16H,4-6,8,15H2,1-3H3 |
| InChIKey | POOHAJQABXZCAT-UHFFFAOYSA-N |
| XLogP | 6.33 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.45 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |