C9H10F3N5 — CID 155463559
1-[3-(trifluoromethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]prop-2-en-1-imine (PubChem CID 155463559) has the molecular formula C9H10F3N5 and a molecular weight of 245.21 g/mol. Its IUPAC name is 1-[3-(trifluoromethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]prop-2-en-1-imine.
| Compound Name | 1-[3-(trifluoromethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]prop-2-en-1-imine |
|---|---|
| PubChem CID | 155463559 |
| Molecular Formula | C9H10F3N5 |
| Molecular Weight | 245.21 g/mol |
| Exact Mass | 245.09 |
| IUPAC Name | 1-[3-(trifluoromethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]prop-2-en-1-imine |
| SMILES | [H]/N=C(\C=C)N1CCn2c(nnc2C(F)(F)F)C1 |
| InChI | InChI=1S/C9H10F3N5/c1-2-6(13)16-3-4-17-7(5-16)14-15-8(17)9(10,11)12/h2,13H,1,3-5H2/b13-6+ |
| InChIKey | VRMHGAVINROYLF-AWNIVKPZSA-N |
| XLogP | 1.28 |
| TPSA | 57.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.21 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|