C11H8ClN3O — CID 155463685
6-chloro-2-ethyl-5-ethynyl-3H-pyrido[3,4-d]pyrimidin-4-one (PubChem CID 155463685) has the molecular formula C11H8ClN3O and a molecular weight of 233.66 g/mol. Its IUPAC name is 6-chloro-2-ethyl-5-ethynyl-3H-pyrido[3,4-d]pyrimidin-4-one.
| Compound Name | 6-chloro-2-ethyl-5-ethynyl-3H-pyrido[3,4-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 155463685 |
| Molecular Formula | C11H8ClN3O |
| Molecular Weight | 233.66 g/mol |
| Exact Mass | 233.04 |
| IUPAC Name | 6-chloro-2-ethyl-5-ethynyl-3H-pyrido[3,4-d]pyrimidin-4-one |
| SMILES | C#Cc1c(Cl)ncc2nc(CC)[nH]c(=O)c12 |
| InChI | InChI=1S/C11H8ClN3O/c1-3-6-9-7(5-13-10(6)12)14-8(4-2)15-11(9)16/h1,5H,4H2,2H3,(H,14,15,16) |
| InChIKey | IDCUHLTVWZPVIV-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.66 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|