C19H13BrF3N3O2 — CID 155464616
N-[(6-bromo-2-pyridinyl)-phenylmethyl]-2-oxo-6-(trifluoromethyl)-1H-pyridine-3-carboxamide (PubChem CID 155464616) has the molecular formula C19H13BrF3N3O2 and a molecular weight of 452.23 g/mol. Its IUPAC name is N-[(6-bromo-2-pyridinyl)-phenylmethyl]-2-oxo-6-(trifluoromethyl)-1H-pyridine-3-carboxamide.
| Compound Name | N-[(6-bromo-2-pyridinyl)-phenylmethyl]-2-oxo-6-(trifluoromethyl)-1H-pyridine-3-carboxamide |
|---|---|
| PubChem CID | 155464616 |
| Molecular Formula | C19H13BrF3N3O2 |
| Molecular Weight | 452.23 g/mol |
| Exact Mass | 451.01 |
| IUPAC Name | N-[(6-bromo-2-pyridinyl)-phenylmethyl]-2-oxo-6-(trifluoromethyl)-1H-pyridine-3-carboxamide |
| SMILES | O=C(NC(c1ccccc1)c1cccc(Br)n1)c1ccc(C(F)(F)F)[nH]c1=O |
| InChI | InChI=1S/C19H13BrF3N3O2/c20-15-8-4-7-13(24-15)16(11-5-2-1-3-6-11)26-18(28)12-9-10-14(19(21,22)23)25-17(12)27/h1-10,16H,(H,25,27)(H,26,28) |
| InChIKey | IMYATOSMESXTGM-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.23 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|