C24H32N6OS — CID 155467851
3-amino-5-[(Z)-2-aminobut-1-enyl]imino-N-[2-[4-(3,8-diazabicyclo[3.2.1]octan-3-yl)phenyl]ethyl]-4-methylidenethiophene-2-carboxamide (PubChem CID 155467851) has the molecular formula C24H32N6OS and a molecular weight of 452.63 g/mol. Its IUPAC name is 3-amino-5-[(Z)-2-aminobut-1-enyl]imino-N-[2-[4-(3,8-diazabicyclo[3.2.1]octan-3-yl)phenyl]ethyl]-4-methylidenethiophene-2-carboxamide.
| Compound Name | 3-amino-5-[(Z)-2-aminobut-1-enyl]imino-N-[2-[4-(3,8-diazabicyclo[3.2.1]octan-3-yl)phenyl]ethyl]-4-methylidenethiophene-2-carboxamide |
|---|---|
| PubChem CID | 155467851 |
| Molecular Formula | C24H32N6OS |
| Molecular Weight | 452.63 g/mol |
| Exact Mass | 452.24 |
| IUPAC Name | 3-amino-5-[(Z)-2-aminobut-1-enyl]imino-N-[2-[4-(3,8-diazabicyclo[3.2.1]octan-3-yl)phenyl]ethyl]-4-methylidenethiophene-2-carboxamide |
| SMILES | C=C1C(N)=C(C(=O)NCCc2ccc(N3CC4CCC(C3)N4)cc2)S/C1=N\C=C(/N)CC |
| InChI | InChI=1S/C24H32N6OS/c1-3-17(25)12-28-24-15(2)21(26)22(32-24)23(31)27-11-10-16-4-8-20(9-5-16)30-13-18-6-7-19(14-30)29-18/h4-5,8-9,12,18-19,29H,2-3,6-7,10-11,13-14,25-26H2,1H3,(H,27,31)/b17-12-,28-24- |
| InChIKey | KJYJEGPPBQKHPU-NCUOHYRSSA-N |
| XLogP | 2.37 |
| TPSA | 108.77 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.63 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'ene_five_het_C(85)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|