C22H25N5O3 — CID 177260563
4-acetyl-N-[2-[4-(3,8-diazabicyclo[3.2.1]octan-3-yl)phenyl]ethyl]pyrrolo[2,3-d][1,2]oxazole-6-carboxamide (PubChem CID 177260563) has the molecular formula C22H25N5O3 and a molecular weight of 407.47 g/mol. Its IUPAC name is 4-acetyl-N-[2-[4-(3,8-diazabicyclo[3.2.1]octan-3-yl)phenyl]ethyl]pyrrolo[2,3-d][1,2]oxazole-6-carboxamide.
| Compound Name | 4-acetyl-N-[2-[4-(3,8-diazabicyclo[3.2.1]octan-3-yl)phenyl]ethyl]pyrrolo[2,3-d][1,2]oxazole-6-carboxamide |
|---|---|
| PubChem CID | 177260563 |
| Molecular Formula | C22H25N5O3 |
| Molecular Weight | 407.47 g/mol |
| Exact Mass | 407.20 |
| IUPAC Name | 4-acetyl-N-[2-[4-(3,8-diazabicyclo[3.2.1]octan-3-yl)phenyl]ethyl]pyrrolo[2,3-d][1,2]oxazole-6-carboxamide |
| SMILES | CC(=O)n1cc(C(=O)NCCc2ccc(N3CC4CCC(C3)N4)cc2)c2oncc21 |
| InChI | InChI=1S/C22H25N5O3/c1-14(28)27-13-19(21-20(27)10-24-30-21)22(29)23-9-8-15-2-6-18(7-3-15)26-11-16-4-5-17(12-26)25-16/h2-3,6-7,10,13,16-17,25H,4-5,8-9,11-12H2,1H3,(H,23,29) |
| InChIKey | WFSSPKISDPVWMF-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 92.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.47 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|