C23H27N5O2S — CID 177260670
6-acetyl-3-amino-N-[2-[4-(3,8-diazabicyclo[3.2.1]octan-3-yl)phenyl]ethyl]thieno[2,3-b]pyrrole-4-carboxamide (PubChem CID 177260670) has the molecular formula C23H27N5O2S and a molecular weight of 437.57 g/mol. Its IUPAC name is 6-acetyl-3-amino-N-[2-[4-(3,8-diazabicyclo[3.2.1]octan-3-yl)phenyl]ethyl]thieno[2,3-b]pyrrole-4-carboxamide.
| Compound Name | 6-acetyl-3-amino-N-[2-[4-(3,8-diazabicyclo[3.2.1]octan-3-yl)phenyl]ethyl]thieno[2,3-b]pyrrole-4-carboxamide |
|---|---|
| PubChem CID | 177260670 |
| Molecular Formula | C23H27N5O2S |
| Molecular Weight | 437.57 g/mol |
| Exact Mass | 437.19 |
| IUPAC Name | 6-acetyl-3-amino-N-[2-[4-(3,8-diazabicyclo[3.2.1]octan-3-yl)phenyl]ethyl]thieno[2,3-b]pyrrole-4-carboxamide |
| SMILES | CC(=O)n1cc(C(=O)NCCc2ccc(N3CC4CCC(C3)N4)cc2)c2c(N)csc21 |
| InChI | InChI=1S/C23H27N5O2S/c1-14(29)28-12-19(21-20(24)13-31-23(21)28)22(30)25-9-8-15-2-6-18(7-3-15)27-10-16-4-5-17(11-27)26-16/h2-3,6-7,12-13,16-17,26H,4-5,8-11,24H2,1H3,(H,25,30) |
| InChIKey | XOOWVLIIIUYFIY-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 92.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.57 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|