C17H23IN3O3P — CID 155469029
tert-butyl 3-(1-iodophosphanyl-5-methylindazol-6-yl)oxypyrrolidine-1-carboxylate (PubChem CID 155469029) has the molecular formula C17H23IN3O3P and a molecular weight of 475.27 g/mol. Its IUPAC name is tert-butyl 3-(1-iodophosphanyl-5-methylindazol-6-yl)oxypyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 3-(1-iodophosphanyl-5-methylindazol-6-yl)oxypyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 155469029 |
| Molecular Formula | C17H23IN3O3P |
| Molecular Weight | 475.27 g/mol |
| Exact Mass | 475.05 |
| IUPAC Name | tert-butyl 3-(1-iodophosphanyl-5-methylindazol-6-yl)oxypyrrolidine-1-carboxylate |
| SMILES | Cc1cc2cnn(PI)c2cc1OC1CCN(C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C17H23IN3O3P/c1-11-7-12-9-19-21(25-18)14(12)8-15(11)23-13-5-6-20(10-13)16(22)24-17(2,3)4/h7-9,13,25H,5-6,10H2,1-4H3 |
| InChIKey | DKYLETHSIFINEU-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 56.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.27 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|