C28H52N2S — CID 155475567
1-[5-[2-[2-(2-cycloheptylbutan-2-yl)cyclobutyl]propan-2-yl]cyclooctyl]-3-methylthiourea (PubChem CID 155475567) has the molecular formula C28H52N2S and a molecular weight of 448.81 g/mol. Its IUPAC name is 1-[5-[2-[2-(2-cycloheptylbutan-2-yl)cyclobutyl]propan-2-yl]cyclooctyl]-3-methylthiourea.
| Compound Name | 1-[5-[2-[2-(2-cycloheptylbutan-2-yl)cyclobutyl]propan-2-yl]cyclooctyl]-3-methylthiourea |
|---|---|
| PubChem CID | 155475567 |
| Molecular Formula | C28H52N2S |
| Molecular Weight | 448.81 g/mol |
| Exact Mass | 448.39 |
| IUPAC Name | 1-[5-[2-[2-(2-cycloheptylbutan-2-yl)cyclobutyl]propan-2-yl]cyclooctyl]-3-methylthiourea |
| SMILES | CCC(C)(C1CCCCCC1)C1CCC1C(C)(C)C1CCCC(NC(=S)NC)CCC1 |
| InChI | InChI=1S/C28H52N2S/c1-6-28(4,22-13-9-7-8-10-14-22)25-20-19-24(25)27(2,3)21-15-11-17-23(18-12-16-21)30-26(31)29-5/h21-25H,6-20H2,1-5H3,(H2,29,30,31) |
| InChIKey | SRSKLLOCVNJVFI-UHFFFAOYSA-N |
| XLogP | 7.86 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.81 |
| LogP ≤ 5 | 7.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|