C19H22FN12O10PS — CID 155476560
5-amino-3-[8-(6-aminopurin-9-yl)-9-fluoro-12-hydroxy-3,3,12-trioxo-2,7,11,13,16-pentaoxa-3λ6-thia-4-aza-12λ5-phosphatricyclo[13.2.1.06,10]octadecan-17-yl]-6H-triazolo[4,5-d]pyrimidin-7-one (PubChem CID 155476560) has the molecular formula C19H22FN12O10PS and a molecular weight of 660.50 g/mol. Its IUPAC name is 5-amino-3-[8-(6-aminopurin-9-yl)-9-fluoro-12-hydroxy-3,3,12-trioxo-2,7,11,13,16-pentaoxa-3λ6-thia-4-aza-12λ5-phosphatricyclo[13.2.1.06,10]octadecan-17-yl]-6H-triazolo[4,5-d]pyrimidin-7-one.
| Compound Name | 5-amino-3-[8-(6-aminopurin-9-yl)-9-fluoro-12-hydroxy-3,3,12-trioxo-2,7,11,13,16-pentaoxa-3λ6-thia-4-aza-12λ5-phosphatricyclo[13.2.1.06,10]octadecan-17-yl]-6H-triazolo[4,5-d]pyrimidin-7-one |
|---|---|
| PubChem CID | 155476560 |
| Molecular Formula | C19H22FN12O10PS |
| Molecular Weight | 660.50 g/mol |
| Exact Mass | 660.10 |
| IUPAC Name | 5-amino-3-[8-(6-aminopurin-9-yl)-9-fluoro-12-hydroxy-3,3,12-trioxo-2,7,11,13,16-pentaoxa-3λ6-thia-4-aza-12λ5-phosphatricyclo[13.2.1.06,10]octadecan-17-yl]-6H-triazolo[4,5-d]pyrimidin-7-one |
| SMILES | Nc1nc2c(nnn2C2OC3COP(=O)(O)OC4C(CNS(=O)(=O)OC2C3)OC(n2cnc3c(N)ncnc32)C4F)c(=O)[nH]1 |
| InChI | InChI=1S/C19H22FN12O10PS/c20-9-12-8(40-18(9)31-5-25-10-13(21)23-4-24-14(10)31)2-26-44(36,37)42-7-1-6(3-38-43(34,35)41-12)39-17(7)32-15-11(29-30-32)16(33)28-19(22)27-15/h4-9,12,17-18,26H,1-3H2,(H,34,35)(H2,21,23,24)(H3,22,27,28,33) |
| InChIKey | JYEWEJFVHBDHBJ-UHFFFAOYSA-N |
| XLogP | -2.22 |
| TPSA | 301.72 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 19 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.50 |
| LogP ≤ 5 | -2.22 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 19 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|