C24H23N7O2 — CID 155477816
(E)-N-[8-amino-6-(4-methyl-3-pyridinyl)-2,7-naphthyridin-3-yl]-4-(4-cyanopiperidin-1-yl)-4-oxobut-2-enamide (PubChem CID 155477816) has the molecular formula C24H23N7O2 and a molecular weight of 441.50 g/mol. Its IUPAC name is (E)-N-[8-amino-6-(4-methyl-3-pyridinyl)-2,7-naphthyridin-3-yl]-4-(4-cyanopiperidin-1-yl)-4-oxobut-2-enamide.
| Compound Name | (E)-N-[8-amino-6-(4-methyl-3-pyridinyl)-2,7-naphthyridin-3-yl]-4-(4-cyanopiperidin-1-yl)-4-oxobut-2-enamide |
|---|---|
| PubChem CID | 155477816 |
| Molecular Formula | C24H23N7O2 |
| Molecular Weight | 441.50 g/mol |
| Exact Mass | 441.19 |
| IUPAC Name | (E)-N-[8-amino-6-(4-methyl-3-pyridinyl)-2,7-naphthyridin-3-yl]-4-(4-cyanopiperidin-1-yl)-4-oxobut-2-enamide |
| SMILES | Cc1ccncc1-c1cc2cc(NC(=O)/C=C/C(=O)N3CCC(C#N)CC3)ncc2c(N)n1 |
| InChI | InChI=1S/C24H23N7O2/c1-15-4-7-27-13-18(15)20-10-17-11-21(28-14-19(17)24(26)29-20)30-22(32)2-3-23(33)31-8-5-16(12-25)6-9-31/h2-4,7,10-11,13-14,16H,5-6,8-9H2,1H3,(H2,26,29)(H,28,30,32)/b3-2+ |
| InChIKey | VVTNSNYZMMEWEH-NSCUHMNNSA-N |
| XLogP | 2.84 |
| TPSA | 137.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.50 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|