C23H23N7O2 — CID 155477820
(Z)-N-[8-amino-6-(4-methyl-3-pyridinyl)-2,7-naphthyridin-3-yl]-N'-(1-cyano-2-methylpropan-2-yl)but-2-enediamide (PubChem CID 155477820) has the molecular formula C23H23N7O2 and a molecular weight of 429.48 g/mol. Its IUPAC name is (Z)-N-[8-amino-6-(4-methyl-3-pyridinyl)-2,7-naphthyridin-3-yl]-N'-(1-cyano-2-methylpropan-2-yl)but-2-enediamide.
| Compound Name | (Z)-N-[8-amino-6-(4-methyl-3-pyridinyl)-2,7-naphthyridin-3-yl]-N'-(1-cyano-2-methylpropan-2-yl)but-2-enediamide |
|---|---|
| PubChem CID | 155477820 |
| Molecular Formula | C23H23N7O2 |
| Molecular Weight | 429.48 g/mol |
| Exact Mass | 429.19 |
| IUPAC Name | (Z)-N-[8-amino-6-(4-methyl-3-pyridinyl)-2,7-naphthyridin-3-yl]-N'-(1-cyano-2-methylpropan-2-yl)but-2-enediamide |
| SMILES | Cc1ccncc1-c1cc2cc(NC(=O)/C=C\C(=O)NC(C)(C)CC#N)ncc2c(N)n1 |
| InChI | InChI=1S/C23H23N7O2/c1-14-6-9-26-12-16(14)18-10-15-11-19(27-13-17(15)22(25)28-18)29-20(31)4-5-21(32)30-23(2,3)7-8-24/h4-6,9-13H,7H2,1-3H3,(H2,25,28)(H,30,32)(H,27,29,31)/b5-4- |
| InChIKey | MPVUNVDOFCYALQ-PLNGDYQASA-N |
| XLogP | 2.89 |
| TPSA | 146.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.48 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|