C25H21N7O2 — CID 155477709
N'-[8-amino-6-(4-methyl-3-pyridinyl)-2,7-naphthyridin-3-yl]-N-[2-(3-cyanophenyl)ethyl]oxamide (PubChem CID 155477709) has the molecular formula C25H21N7O2 and a molecular weight of 451.49 g/mol. Its IUPAC name is N'-[8-amino-6-(4-methyl-3-pyridinyl)-2,7-naphthyridin-3-yl]-N-[2-(3-cyanophenyl)ethyl]oxamide.
| Compound Name | N'-[8-amino-6-(4-methyl-3-pyridinyl)-2,7-naphthyridin-3-yl]-N-[2-(3-cyanophenyl)ethyl]oxamide |
|---|---|
| PubChem CID | 155477709 |
| Molecular Formula | C25H21N7O2 |
| Molecular Weight | 451.49 g/mol |
| Exact Mass | 451.18 |
| IUPAC Name | N'-[8-amino-6-(4-methyl-3-pyridinyl)-2,7-naphthyridin-3-yl]-N-[2-(3-cyanophenyl)ethyl]oxamide |
| SMILES | Cc1ccncc1-c1cc2cc(NC(=O)C(=O)NCCc3cccc(C#N)c3)ncc2c(N)n1 |
| InChI | InChI=1S/C25H21N7O2/c1-15-5-7-28-13-19(15)21-10-18-11-22(30-14-20(18)23(27)31-21)32-25(34)24(33)29-8-6-16-3-2-4-17(9-16)12-26/h2-5,7,9-11,13-14H,6,8H2,1H3,(H2,27,31)(H,29,33)(H,30,32,34) |
| InChIKey | MZIALEATDNMPRY-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 146.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.49 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|