C9H13N3O2 — CID 155480196
1-[1-(oxolan-2-ylmethyl)-1,2,4-triazol-3-yl]ethanone (PubChem CID 155480196) has the molecular formula C9H13N3O2 and a molecular weight of 195.22 g/mol. Its IUPAC name is 1-[1-(oxolan-2-ylmethyl)-1,2,4-triazol-3-yl]ethanone.
| Compound Name | 1-[1-(oxolan-2-ylmethyl)-1,2,4-triazol-3-yl]ethanone |
|---|---|
| PubChem CID | 155480196 |
| Molecular Formula | C9H13N3O2 |
| Molecular Weight | 195.22 g/mol |
| Exact Mass | 195.10 |
| IUPAC Name | 1-[1-(oxolan-2-ylmethyl)-1,2,4-triazol-3-yl]ethanone |
| SMILES | CC(=O)c1ncn(CC2CCCO2)n1 |
| InChI | InChI=1S/C9H13N3O2/c1-7(13)9-10-6-12(11-9)5-8-3-2-4-14-8/h6,8H,2-5H2,1H3 |
| InChIKey | BPKROVIKMFQMKC-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.22 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |