C30H33N7O2 — CID 155483063
5-[[(1S,5R)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl]oxy]-N-[3-methyl-4-[(1E)-1-(2-methyl-1,2,4-triazol-3-yl)buta-1,3-dien-2-yl]oxyphenyl]quinazolin-4-amine (PubChem CID 155483063) has the molecular formula C30H33N7O2 and a molecular weight of 523.64 g/mol. Its IUPAC name is 5-[[(1S,5R)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl]oxy]-N-[3-methyl-4-[(1E)-1-(2-methyl-1,2,4-triazol-3-yl)buta-1,3-dien-2-yl]oxyphenyl]quinazolin-4-amine.
| Compound Name | 5-[[(1S,5R)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl]oxy]-N-[3-methyl-4-[(1E)-1-(2-methyl-1,2,4-triazol-3-yl)buta-1,3-dien-2-yl]oxyphenyl]quinazolin-4-amine |
|---|---|
| PubChem CID | 155483063 |
| Molecular Formula | C30H33N7O2 |
| Molecular Weight | 523.64 g/mol |
| Exact Mass | 523.27 |
| IUPAC Name | 5-[[(1S,5R)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl]oxy]-N-[3-methyl-4-[(1E)-1-(2-methyl-1,2,4-triazol-3-yl)buta-1,3-dien-2-yl]oxyphenyl]quinazolin-4-amine |
| SMILES | C=C/C(=C\c1ncnn1C)Oc1ccc(Nc2ncnc3cccc(OC4C[C@H]5CC[C@@H](C4)N5C)c23)cc1C |
| InChI | InChI=1S/C30H33N7O2/c1-5-23(16-28-32-18-34-37(28)4)38-26-12-9-20(13-19(26)2)35-30-29-25(31-17-33-30)7-6-8-27(29)39-24-14-21-10-11-22(15-24)36(21)3/h5-9,12-13,16-18,21-22,24H,1,10-11,14-15H2,2-4H3,(H,31,33,35)/b23-16+/t21-,22+,24? |
| InChIKey | FCZAAIVQODUQCZ-JQLGLGRUSA-N |
| XLogP | 5.42 |
| TPSA | 90.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.64 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|