C18H14BrF3N4O2S — CID 155485703
N-[4-(4-bromopyrazol-1-yl)-3-sulfinamoylphenyl]-2-[2-(trifluoromethyl)phenyl]acetamide (PubChem CID 155485703) has the molecular formula C18H14BrF3N4O2S and a molecular weight of 487.30 g/mol. Its IUPAC name is N-[4-(4-bromopyrazol-1-yl)-3-sulfinamoylphenyl]-2-[2-(trifluoromethyl)phenyl]acetamide.
| Compound Name | N-[4-(4-bromopyrazol-1-yl)-3-sulfinamoylphenyl]-2-[2-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 155485703 |
| Molecular Formula | C18H14BrF3N4O2S |
| Molecular Weight | 487.30 g/mol |
| Exact Mass | 486.00 |
| IUPAC Name | N-[4-(4-bromopyrazol-1-yl)-3-sulfinamoylphenyl]-2-[2-(trifluoromethyl)phenyl]acetamide |
| SMILES | NS(=O)c1cc(NC(=O)Cc2ccccc2C(F)(F)F)ccc1-n1cc(Br)cn1 |
| InChI | InChI=1S/C18H14BrF3N4O2S/c19-12-9-24-26(10-12)15-6-5-13(8-16(15)29(23)28)25-17(27)7-11-3-1-2-4-14(11)18(20,21)22/h1-6,8-10H,7,23H2,(H,25,27) |
| InChIKey | GNGQXOAOROZXGY-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 90.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.30 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |