C19H17FN3O4S- — CID 163848517
5-[[2-(2-ethoxyphenyl)acetyl]amino]-2-(4-fluoropyrazol-1-yl)benzenesulfinate (PubChem CID 163848517) has the molecular formula C19H17FN3O4S- and a molecular weight of 402.43 g/mol. Its IUPAC name is 5-[[2-(2-ethoxyphenyl)acetyl]amino]-2-(4-fluoropyrazol-1-yl)benzenesulfinate.
| Compound Name | 5-[[2-(2-ethoxyphenyl)acetyl]amino]-2-(4-fluoropyrazol-1-yl)benzenesulfinate |
|---|---|
| PubChem CID | 163848517 |
| Molecular Formula | C19H17FN3O4S- |
| Molecular Weight | 402.43 g/mol |
| Exact Mass | 402.09 |
| IUPAC Name | 5-[[2-(2-ethoxyphenyl)acetyl]amino]-2-(4-fluoropyrazol-1-yl)benzenesulfinate |
| SMILES | CCOc1ccccc1CC(=O)Nc1ccc(-n2cc(F)cn2)c(S(=O)[O-])c1 |
| InChI | InChI=1S/C19H18FN3O4S/c1-2-27-17-6-4-3-5-13(17)9-19(24)22-15-7-8-16(18(10-15)28(25)26)23-12-14(20)11-21-23/h3-8,10-12H,2,9H2,1H3,(H,22,24)(H,25,26)/p-1 |
| InChIKey | GXQMOCJUOMKOCR-UHFFFAOYSA-M |
| XLogP | 2.83 |
| TPSA | 96.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.43 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|