C18H18Cl2INO3S — CID 155490548
N-(3-chloro-2-hydroxypropyl)-N-[(E)-1-chloro-2-iodo-2-phenylethenyl]-4-methylbenzenesulfonamide (PubChem CID 155490548) has the molecular formula C18H18Cl2INO3S and a molecular weight of 526.22 g/mol. Its IUPAC name is N-(3-chloro-2-hydroxypropyl)-N-[(E)-1-chloro-2-iodo-2-phenylethenyl]-4-methylbenzenesulfonamide.
| Compound Name | N-(3-chloro-2-hydroxypropyl)-N-[(E)-1-chloro-2-iodo-2-phenylethenyl]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 155490548 |
| Molecular Formula | C18H18Cl2INO3S |
| Molecular Weight | 526.22 g/mol |
| Exact Mass | 524.94 |
| IUPAC Name | N-(3-chloro-2-hydroxypropyl)-N-[(E)-1-chloro-2-iodo-2-phenylethenyl]-4-methylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)N(CC(O)CCl)/C(Cl)=C(\I)c2ccccc2)cc1 |
| InChI | InChI=1S/C18H18Cl2INO3S/c1-13-7-9-16(10-8-13)26(24,25)22(12-15(23)11-19)18(20)17(21)14-5-3-2-4-6-14/h2-10,15,23H,11-12H2,1H3/b18-17- |
| InChIKey | FQISDNKDNPCLPQ-ZCXUNETKSA-N |
| XLogP | 4.59 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.22 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|