C21H22ClN5O2S — CID 155490676
1-[[1-(4-chloro-3-methoxyphenyl)piperidine-4-carbonyl]amino]-3-(4-cyanophenyl)thiourea (PubChem CID 155490676) has the molecular formula C21H22ClN5O2S and a molecular weight of 443.96 g/mol. Its IUPAC name is 1-[[1-(4-chloro-3-methoxyphenyl)piperidine-4-carbonyl]amino]-3-(4-cyanophenyl)thiourea.
| Compound Name | 1-[[1-(4-chloro-3-methoxyphenyl)piperidine-4-carbonyl]amino]-3-(4-cyanophenyl)thiourea |
|---|---|
| PubChem CID | 155490676 |
| Molecular Formula | C21H22ClN5O2S |
| Molecular Weight | 443.96 g/mol |
| Exact Mass | 443.12 |
| IUPAC Name | 1-[[1-(4-chloro-3-methoxyphenyl)piperidine-4-carbonyl]amino]-3-(4-cyanophenyl)thiourea |
| SMILES | COc1cc(N2CCC(C(=O)NNC(=S)Nc3ccc(C#N)cc3)CC2)ccc1Cl |
| InChI | InChI=1S/C21H22ClN5O2S/c1-29-19-12-17(6-7-18(19)22)27-10-8-15(9-11-27)20(28)25-26-21(30)24-16-4-2-14(13-23)3-5-16/h2-7,12,15H,8-11H2,1H3,(H,25,28)(H2,24,26,30) |
| InChIKey | LRBFDWGPFPVCMZ-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 89.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.96 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|