C20H21Cl3N4O2S — CID 155490678
1-[[1-(4-chloro-3-methoxyphenyl)piperidine-4-carbonyl]amino]-3-(3,5-dichlorophenyl)thiourea (PubChem CID 155490678) has the molecular formula C20H21Cl3N4O2S and a molecular weight of 487.84 g/mol. Its IUPAC name is 1-[[1-(4-chloro-3-methoxyphenyl)piperidine-4-carbonyl]amino]-3-(3,5-dichlorophenyl)thiourea.
| Compound Name | 1-[[1-(4-chloro-3-methoxyphenyl)piperidine-4-carbonyl]amino]-3-(3,5-dichlorophenyl)thiourea |
|---|---|
| PubChem CID | 155490678 |
| Molecular Formula | C20H21Cl3N4O2S |
| Molecular Weight | 487.84 g/mol |
| Exact Mass | 486.05 |
| IUPAC Name | 1-[[1-(4-chloro-3-methoxyphenyl)piperidine-4-carbonyl]amino]-3-(3,5-dichlorophenyl)thiourea |
| SMILES | COc1cc(N2CCC(C(=O)NNC(=S)Nc3cc(Cl)cc(Cl)c3)CC2)ccc1Cl |
| InChI | InChI=1S/C20H21Cl3N4O2S/c1-29-18-11-16(2-3-17(18)23)27-6-4-12(5-7-27)19(28)25-26-20(30)24-15-9-13(21)8-14(22)10-15/h2-3,8-12H,4-7H2,1H3,(H,25,28)(H2,24,26,30) |
| InChIKey | UCIIZADVUREIMY-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 65.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.84 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|