C22H27N5O3 — CID 155493685
3-[(3,4-dimethoxyphenyl)methyl]-1-[2-(1H-imidazol-5-yl)ethyl]-5-[(1R,2S,4S)-7-oxabicyclo[2.2.1]heptan-2-yl]-1,2,4-triazole (PubChem CID 155493685) has the molecular formula C22H27N5O3 and a molecular weight of 409.49 g/mol. Its IUPAC name is 3-[(3,4-dimethoxyphenyl)methyl]-1-[2-(1H-imidazol-5-yl)ethyl]-5-[(1R,2S,4S)-7-oxabicyclo[2.2.1]heptan-2-yl]-1,2,4-triazole.
| Compound Name | 3-[(3,4-dimethoxyphenyl)methyl]-1-[2-(1H-imidazol-5-yl)ethyl]-5-[(1R,2S,4S)-7-oxabicyclo[2.2.1]heptan-2-yl]-1,2,4-triazole |
|---|---|
| PubChem CID | 155493685 |
| Molecular Formula | C22H27N5O3 |
| Molecular Weight | 409.49 g/mol |
| Exact Mass | 409.21 |
| IUPAC Name | 3-[(3,4-dimethoxyphenyl)methyl]-1-[2-(1H-imidazol-5-yl)ethyl]-5-[(1R,2S,4S)-7-oxabicyclo[2.2.1]heptan-2-yl]-1,2,4-triazole |
| SMILES | COc1ccc(Cc2nc([C@@H]3C[C@@H]4CC[C@H]3O4)n(CCc3cnc[nH]3)n2)cc1OC |
| InChI | InChI=1S/C22H27N5O3/c1-28-19-5-3-14(9-20(19)29-2)10-21-25-22(17-11-16-4-6-18(17)30-16)27(26-21)8-7-15-12-23-13-24-15/h3,5,9,12-13,16-18H,4,6-8,10-11H2,1-2H3,(H,23,24)/t16-,17+,18+/m0/s1 |
| InChIKey | CATYIFHUVHWDAZ-RCCFBDPRSA-N |
| XLogP | 2.89 |
| TPSA | 87.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.49 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |