C17H20N2O4 — CID 95907115
3-[(3,4-dimethoxyphenyl)methyl]-5-[(1S,2R,4R)-7-oxabicyclo[2.2.1]heptan-2-yl]-1,2,4-oxadiazole (PubChem CID 95907115) has the molecular formula C17H20N2O4 and a molecular weight of 316.36 g/mol. Its IUPAC name is 3-[(3,4-dimethoxyphenyl)methyl]-5-[(1S,2R,4R)-7-oxabicyclo[2.2.1]heptan-2-yl]-1,2,4-oxadiazole.
| Compound Name | 3-[(3,4-dimethoxyphenyl)methyl]-5-[(1S,2R,4R)-7-oxabicyclo[2.2.1]heptan-2-yl]-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 95907115 |
| Molecular Formula | C17H20N2O4 |
| Molecular Weight | 316.36 g/mol |
| Exact Mass | 316.14 |
| IUPAC Name | 3-[(3,4-dimethoxyphenyl)methyl]-5-[(1S,2R,4R)-7-oxabicyclo[2.2.1]heptan-2-yl]-1,2,4-oxadiazole |
| SMILES | COc1ccc(Cc2noc([C@@H]3C[C@H]4CC[C@@H]3O4)n2)cc1OC |
| InChI | InChI=1S/C17H20N2O4/c1-20-14-5-3-10(7-15(14)21-2)8-16-18-17(23-19-16)12-9-11-4-6-13(12)22-11/h3,5,7,11-13H,4,6,8-9H2,1-2H3/t11-,12-,13+/m1/s1 |
| InChIKey | JHYNVADYZJPQKO-UPJWGTAASA-N |
| XLogP | 2.71 |
| TPSA | 66.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.36 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |