C17H18N2O4 — CID 128848453
3-(2,3-dihydro-1,4-benzodioxin-3-ylmethyl)-5-[(1S,2R,4R)-7-oxabicyclo[2.2.1]heptan-2-yl]-1,2,4-oxadiazole (PubChem CID 128848453) has the molecular formula C17H18N2O4 and a molecular weight of 314.34 g/mol. Its IUPAC name is 3-(2,3-dihydro-1,4-benzodioxin-3-ylmethyl)-5-[(1S,2R,4R)-7-oxabicyclo[2.2.1]heptan-2-yl]-1,2,4-oxadiazole.
| Compound Name | 3-(2,3-dihydro-1,4-benzodioxin-3-ylmethyl)-5-[(1S,2R,4R)-7-oxabicyclo[2.2.1]heptan-2-yl]-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 128848453 |
| Molecular Formula | C17H18N2O4 |
| Molecular Weight | 314.34 g/mol |
| Exact Mass | 314.13 |
| IUPAC Name | 3-(2,3-dihydro-1,4-benzodioxin-3-ylmethyl)-5-[(1S,2R,4R)-7-oxabicyclo[2.2.1]heptan-2-yl]-1,2,4-oxadiazole |
| SMILES | c1ccc2c(c1)OCC(Cc1noc([C@@H]3C[C@H]4CC[C@@H]3O4)n1)O2 |
| InChI | InChI=1S/C17H18N2O4/c1-2-4-15-14(3-1)20-9-11(22-15)8-16-18-17(23-19-16)12-7-10-5-6-13(12)21-10/h1-4,10-13H,5-9H2/t10-,11?,12-,13+/m1/s1 |
| InChIKey | ZQDFVLMBJHBZND-ODWCKFRGSA-N |
| XLogP | 2.49 |
| TPSA | 66.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.34 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |