C19H28N4O4 — CID 155498936
(1S,2S,4S)-2-amino-4-[5-[(3,4-dimethoxyphenyl)methyl]-2-(2-methoxyethyl)-1,2,4-triazol-3-yl]cyclopentan-1-ol (PubChem CID 155498936) has the molecular formula C19H28N4O4 and a molecular weight of 376.46 g/mol. Its IUPAC name is (1S,2S,4S)-2-amino-4-[5-[(3,4-dimethoxyphenyl)methyl]-2-(2-methoxyethyl)-1,2,4-triazol-3-yl]cyclopentan-1-ol.
| Compound Name | (1S,2S,4S)-2-amino-4-[5-[(3,4-dimethoxyphenyl)methyl]-2-(2-methoxyethyl)-1,2,4-triazol-3-yl]cyclopentan-1-ol |
|---|---|
| PubChem CID | 155498936 |
| Molecular Formula | C19H28N4O4 |
| Molecular Weight | 376.46 g/mol |
| Exact Mass | 376.21 |
| IUPAC Name | (1S,2S,4S)-2-amino-4-[5-[(3,4-dimethoxyphenyl)methyl]-2-(2-methoxyethyl)-1,2,4-triazol-3-yl]cyclopentan-1-ol |
| SMILES | COCCn1nc(Cc2ccc(OC)c(OC)c2)nc1[C@H]1C[C@H](N)[C@@H](O)C1 |
| InChI | InChI=1S/C19H28N4O4/c1-25-7-6-23-19(13-10-14(20)15(24)11-13)21-18(22-23)9-12-4-5-16(26-2)17(8-12)27-3/h4-5,8,13-15,24H,6-7,9-11,20H2,1-3H3/t13-,14-,15-/m0/s1 |
| InChIKey | FLDGDMSRKYYNKX-KKUMJFAQSA-N |
| XLogP | 1.10 |
| TPSA | 104.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.46 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |