C19H25N3O3 — CID 155495188
2-[(3S,7S,8aS)-7-[2-(4-methoxyphenyl)imidazol-1-yl]-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-yl]ethanol (PubChem CID 155495188) has the molecular formula C19H25N3O3 and a molecular weight of 343.43 g/mol. Its IUPAC name is 2-[(3S,7S,8aS)-7-[2-(4-methoxyphenyl)imidazol-1-yl]-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-yl]ethanol.
| Compound Name | 2-[(3S,7S,8aS)-7-[2-(4-methoxyphenyl)imidazol-1-yl]-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-yl]ethanol |
|---|---|
| PubChem CID | 155495188 |
| Molecular Formula | C19H25N3O3 |
| Molecular Weight | 343.43 g/mol |
| Exact Mass | 343.19 |
| IUPAC Name | 2-[(3S,7S,8aS)-7-[2-(4-methoxyphenyl)imidazol-1-yl]-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-yl]ethanol |
| SMILES | COc1ccc(-c2nccn2[C@H]2C[C@H]3CO[C@@H](CCO)CN3C2)cc1 |
| InChI | InChI=1S/C19H25N3O3/c1-24-17-4-2-14(3-5-17)19-20-7-8-22(19)15-10-16-13-25-18(6-9-23)12-21(16)11-15/h2-5,7-8,15-16,18,23H,6,9-13H2,1H3/t15-,16-,18-/m0/s1 |
| InChIKey | DHPMCVROMGJFGE-BQFCYCMXSA-N |
| XLogP | 1.96 |
| TPSA | 59.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.43 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |