C20H26FN3O5 — CID 155940942
2-[(3S,7R,8aS)-7-[2-(2-fluoro-5-methoxyphenyl)imidazol-1-yl]-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-yl]ethanol;formic acid (PubChem CID 155940942) has the molecular formula C20H26FN3O5 and a molecular weight of 407.44 g/mol. Its IUPAC name is 2-[(3S,7R,8aS)-7-[2-(2-fluoro-5-methoxyphenyl)imidazol-1-yl]-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-yl]ethanol;formic acid.
| Compound Name | 2-[(3S,7R,8aS)-7-[2-(2-fluoro-5-methoxyphenyl)imidazol-1-yl]-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-yl]ethanol;formic acid |
|---|---|
| PubChem CID | 155940942 |
| Molecular Formula | C20H26FN3O5 |
| Molecular Weight | 407.44 g/mol |
| Exact Mass | 407.19 |
| IUPAC Name | 2-[(3S,7R,8aS)-7-[2-(2-fluoro-5-methoxyphenyl)imidazol-1-yl]-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-yl]ethanol;formic acid |
| SMILES | COc1ccc(F)c(-c2nccn2[C@@H]2C[C@H]3CO[C@@H](CCO)CN3C2)c1.O=CO |
| InChI | InChI=1S/C19H24FN3O3.CH2O2/c1-25-15-2-3-18(20)17(9-15)19-21-5-6-23(19)13-8-14-12-26-16(4-7-24)11-22(14)10-13;2-1-3/h2-3,5-6,9,13-14,16,24H,4,7-8,10-12H2,1H3;1H,(H,2,3)/t13-,14+,16+;/m1./s1 |
| InChIKey | RCTIICQPIYLQGQ-FNIUFUSKSA-N |
| XLogP | 1.80 |
| TPSA | 97.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.44 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|