C18H24ClFN2O — CID 155497289
1-[(1S,5S,6R,7R)-3-[(4-chloro-2-fluorophenyl)methyl]-10-oxa-3-azatricyclo[5.2.1.01,5]decan-6-yl]-N,N-dimethylmethanamine (PubChem CID 155497289) has the molecular formula C18H24ClFN2O and a molecular weight of 338.85 g/mol. Its IUPAC name is 1-[(1S,5S,6R,7R)-3-[(4-chloro-2-fluorophenyl)methyl]-10-oxa-3-azatricyclo[5.2.1.01,5]decan-6-yl]-N,N-dimethylmethanamine.
| Compound Name | 1-[(1S,5S,6R,7R)-3-[(4-chloro-2-fluorophenyl)methyl]-10-oxa-3-azatricyclo[5.2.1.01,5]decan-6-yl]-N,N-dimethylmethanamine |
|---|---|
| PubChem CID | 155497289 |
| Molecular Formula | C18H24ClFN2O |
| Molecular Weight | 338.85 g/mol |
| Exact Mass | 338.16 |
| IUPAC Name | 1-[(1S,5S,6R,7R)-3-[(4-chloro-2-fluorophenyl)methyl]-10-oxa-3-azatricyclo[5.2.1.01,5]decan-6-yl]-N,N-dimethylmethanamine |
| SMILES | CN(C)C[C@H]1[C@H]2CN(Cc3ccc(Cl)cc3F)C[C@]23CC[C@H]1O3 |
| InChI | InChI=1S/C18H24ClFN2O/c1-21(2)9-14-15-10-22(11-18(15)6-5-17(14)23-18)8-12-3-4-13(19)7-16(12)20/h3-4,7,14-15,17H,5-6,8-11H2,1-2H3/t14-,15+,17+,18+/m0/s1 |
| InChIKey | ZSWQMDGBVUATRR-BURFUSLBSA-N |
| XLogP | 3.02 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.85 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |