C18H24ClFN2O5S — CID 171317141
1-[(1R,5R,6S,7S)-3-(2-chloro-4-fluorophenyl)sulfonyl-10-oxa-3-azatricyclo[5.2.1.01,5]decan-6-yl]-N,N-dimethylmethanamine;formic acid (PubChem CID 171317141) has the molecular formula C18H24ClFN2O5S and a molecular weight of 434.92 g/mol. Its IUPAC name is 1-[(1R,5R,6S,7S)-3-(2-chloro-4-fluorophenyl)sulfonyl-10-oxa-3-azatricyclo[5.2.1.01,5]decan-6-yl]-N,N-dimethylmethanamine;formic acid.
| Compound Name | 1-[(1R,5R,6S,7S)-3-(2-chloro-4-fluorophenyl)sulfonyl-10-oxa-3-azatricyclo[5.2.1.01,5]decan-6-yl]-N,N-dimethylmethanamine;formic acid |
|---|---|
| PubChem CID | 171317141 |
| Molecular Formula | C18H24ClFN2O5S |
| Molecular Weight | 434.92 g/mol |
| Exact Mass | 434.11 |
| IUPAC Name | 1-[(1R,5R,6S,7S)-3-(2-chloro-4-fluorophenyl)sulfonyl-10-oxa-3-azatricyclo[5.2.1.01,5]decan-6-yl]-N,N-dimethylmethanamine;formic acid |
| SMILES | CN(C)C[C@H]1[C@@H]2CC[C@@]3(CN(S(=O)(=O)c4ccc(F)cc4Cl)C[C@@H]13)O2.O=CO |
| InChI | InChI=1S/C17H22ClFN2O3S.CH2O2/c1-20(2)8-12-13-9-21(10-17(13)6-5-15(12)24-17)25(22,23)16-4-3-11(19)7-14(16)18;2-1-3/h3-4,7,12-13,15H,5-6,8-10H2,1-2H3;1H,(H,2,3)/t12-,13+,15+,17+;/m1./s1 |
| InChIKey | NFXKUOQFIMWBRI-KCRYEIESSA-N |
| XLogP | 1.91 |
| TPSA | 87.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.92 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|