C17H23NO6S — CID 155505353
[(1S,5S,6R,7R)-3-(2,5-dimethoxyphenyl)sulfonyl-10-oxa-3-azatricyclo[5.2.1.01,5]decan-6-yl]methanol (PubChem CID 155505353) has the molecular formula C17H23NO6S and a molecular weight of 369.44 g/mol. Its IUPAC name is [(1S,5S,6R,7R)-3-(2,5-dimethoxyphenyl)sulfonyl-10-oxa-3-azatricyclo[5.2.1.01,5]decan-6-yl]methanol.
| Compound Name | [(1S,5S,6R,7R)-3-(2,5-dimethoxyphenyl)sulfonyl-10-oxa-3-azatricyclo[5.2.1.01,5]decan-6-yl]methanol |
|---|---|
| PubChem CID | 155505353 |
| Molecular Formula | C17H23NO6S |
| Molecular Weight | 369.44 g/mol |
| Exact Mass | 369.12 |
| IUPAC Name | [(1S,5S,6R,7R)-3-(2,5-dimethoxyphenyl)sulfonyl-10-oxa-3-azatricyclo[5.2.1.01,5]decan-6-yl]methanol |
| SMILES | COc1ccc(OC)c(S(=O)(=O)N2C[C@@H]3[C@H](CO)[C@H]4CC[C@]3(C2)O4)c1 |
| InChI | InChI=1S/C17H23NO6S/c1-22-11-3-4-15(23-2)16(7-11)25(20,21)18-8-13-12(9-19)14-5-6-17(13,10-18)24-14/h3-4,7,12-14,19H,5-6,8-10H2,1-2H3/t12-,13+,14+,17+/m0/s1 |
| InChIKey | XHXUPKIMXUCNFU-ZOMKSWQUSA-N |
| XLogP | 0.86 |
| TPSA | 85.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.44 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |