C18H26N2O4S — CID 155494941
1-[(1S,5S,6R,7R)-3-(3-methoxyphenyl)sulfonyl-10-oxa-3-azatricyclo[5.2.1.01,5]decan-6-yl]-N,N-dimethylmethanamine (PubChem CID 155494941) has the molecular formula C18H26N2O4S and a molecular weight of 366.48 g/mol. Its IUPAC name is 1-[(1S,5S,6R,7R)-3-(3-methoxyphenyl)sulfonyl-10-oxa-3-azatricyclo[5.2.1.01,5]decan-6-yl]-N,N-dimethylmethanamine.
| Compound Name | 1-[(1S,5S,6R,7R)-3-(3-methoxyphenyl)sulfonyl-10-oxa-3-azatricyclo[5.2.1.01,5]decan-6-yl]-N,N-dimethylmethanamine |
|---|---|
| PubChem CID | 155494941 |
| Molecular Formula | C18H26N2O4S |
| Molecular Weight | 366.48 g/mol |
| Exact Mass | 366.16 |
| IUPAC Name | 1-[(1S,5S,6R,7R)-3-(3-methoxyphenyl)sulfonyl-10-oxa-3-azatricyclo[5.2.1.01,5]decan-6-yl]-N,N-dimethylmethanamine |
| SMILES | COc1cccc(S(=O)(=O)N2C[C@@H]3[C@H](CN(C)C)[C@H]4CC[C@]3(C2)O4)c1 |
| InChI | InChI=1S/C18H26N2O4S/c1-19(2)10-15-16-11-20(12-18(16)8-7-17(15)24-18)25(21,22)14-6-4-5-13(9-14)23-3/h4-6,9,15-17H,7-8,10-12H2,1-3H3/t15-,16+,17+,18+/m0/s1 |
| InChIKey | PFHDZCDQMHHSQR-BSDSXHPESA-N |
| XLogP | 1.42 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.48 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |