C19H24Cl2N2O4 — CID 163338129
(2,3-dichlorophenyl)-[(1S,5S,6R,7R)-6-[(dimethylamino)methyl]-10-oxa-3-azatricyclo[5.2.1.01,5]decan-3-yl]methanone;formic acid (PubChem CID 163338129) has the molecular formula C19H24Cl2N2O4 and a molecular weight of 415.32 g/mol. Its IUPAC name is (2,3-dichlorophenyl)-[(1S,5S,6R,7R)-6-[(dimethylamino)methyl]-10-oxa-3-azatricyclo[5.2.1.01,5]decan-3-yl]methanone;formic acid.
| Compound Name | (2,3-dichlorophenyl)-[(1S,5S,6R,7R)-6-[(dimethylamino)methyl]-10-oxa-3-azatricyclo[5.2.1.01,5]decan-3-yl]methanone;formic acid |
|---|---|
| PubChem CID | 163338129 |
| Molecular Formula | C19H24Cl2N2O4 |
| Molecular Weight | 415.32 g/mol |
| Exact Mass | 414.11 |
| IUPAC Name | (2,3-dichlorophenyl)-[(1S,5S,6R,7R)-6-[(dimethylamino)methyl]-10-oxa-3-azatricyclo[5.2.1.01,5]decan-3-yl]methanone;formic acid |
| SMILES | CN(C)C[C@H]1[C@H]2CN(C(=O)c3cccc(Cl)c3Cl)C[C@]23CC[C@H]1O3.O=CO |
| InChI | InChI=1S/C18H22Cl2N2O2.CH2O2/c1-21(2)8-12-13-9-22(10-18(13)7-6-15(12)24-18)17(23)11-4-3-5-14(19)16(11)20;2-1-3/h3-5,12-13,15H,6-10H2,1-2H3;1H,(H,2,3)/t12-,13+,15+,18+;/m0./s1 |
| InChIKey | PFDHVINRRZKGTR-LWESSGKYSA-N |
| XLogP | 2.88 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.32 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|