C23H31N3O2 — CID 162636233
[(1R,5R,6S,7S)-6-[(dimethylamino)methyl]-10-oxa-3-azatricyclo[5.2.1.01,5]decan-3-yl]-(1,3,7-trimethylindol-2-yl)methanone (PubChem CID 162636233) has the molecular formula C23H31N3O2 and a molecular weight of 381.52 g/mol. Its IUPAC name is [(1R,5R,6S,7S)-6-[(dimethylamino)methyl]-10-oxa-3-azatricyclo[5.2.1.01,5]decan-3-yl]-(1,3,7-trimethylindol-2-yl)methanone.
| Compound Name | [(1R,5R,6S,7S)-6-[(dimethylamino)methyl]-10-oxa-3-azatricyclo[5.2.1.01,5]decan-3-yl]-(1,3,7-trimethylindol-2-yl)methanone |
|---|---|
| PubChem CID | 162636233 |
| Molecular Formula | C23H31N3O2 |
| Molecular Weight | 381.52 g/mol |
| Exact Mass | 381.24 |
| IUPAC Name | [(1R,5R,6S,7S)-6-[(dimethylamino)methyl]-10-oxa-3-azatricyclo[5.2.1.01,5]decan-3-yl]-(1,3,7-trimethylindol-2-yl)methanone |
| SMILES | Cc1c(C(=O)N2C[C@H]3[C@@H](CN(C)C)[C@@H]4CC[C@@]3(C2)O4)n(C)c2c(C)cccc12 |
| InChI | InChI=1S/C23H31N3O2/c1-14-7-6-8-16-15(2)21(25(5)20(14)16)22(27)26-12-18-17(11-24(3)4)19-9-10-23(18,13-26)28-19/h6-8,17-19H,9-13H2,1-5H3/t17-,18+,19+,23+/m1/s1 |
| InChIKey | DXUXNSSVCZERTF-XQQXVUDOSA-N |
| XLogP | 2.98 |
| TPSA | 37.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.52 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|