C15H22N4O2S — CID 163307919
(2-amino-1,3-thiazol-4-yl)-[(1R,5R,6S,7S)-6-[(dimethylamino)methyl]-10-oxa-3-azatricyclo[5.2.1.01,5]decan-3-yl]methanone (PubChem CID 163307919) has the molecular formula C15H22N4O2S and a molecular weight of 322.43 g/mol. Its IUPAC name is (2-amino-1,3-thiazol-4-yl)-[(1R,5R,6S,7S)-6-[(dimethylamino)methyl]-10-oxa-3-azatricyclo[5.2.1.01,5]decan-3-yl]methanone.
| Compound Name | (2-amino-1,3-thiazol-4-yl)-[(1R,5R,6S,7S)-6-[(dimethylamino)methyl]-10-oxa-3-azatricyclo[5.2.1.01,5]decan-3-yl]methanone |
|---|---|
| PubChem CID | 163307919 |
| Molecular Formula | C15H22N4O2S |
| Molecular Weight | 322.43 g/mol |
| Exact Mass | 322.15 |
| IUPAC Name | (2-amino-1,3-thiazol-4-yl)-[(1R,5R,6S,7S)-6-[(dimethylamino)methyl]-10-oxa-3-azatricyclo[5.2.1.01,5]decan-3-yl]methanone |
| SMILES | CN(C)C[C@H]1[C@@H]2CC[C@@]3(CN(C(=O)c4csc(N)n4)C[C@@H]13)O2 |
| InChI | InChI=1S/C15H22N4O2S/c1-18(2)5-9-10-6-19(8-15(10)4-3-12(9)21-15)13(20)11-7-22-14(16)17-11/h7,9-10,12H,3-6,8H2,1-2H3,(H2,16,17)/t9-,10+,12+,15+/m1/s1 |
| InChIKey | LXERJDGTPGUTEJ-YOLKCXPHSA-N |
| XLogP | 0.91 |
| TPSA | 71.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.43 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |