C19H23N5O3S — CID 165421318
N-[[(1S,5S,6R,7R)-3-[2-(methylamino)-1,3-thiazole-4-carbonyl]-10-oxa-3-azatricyclo[5.2.1.01,5]decan-6-yl]methyl]-1H-pyrrole-3-carboxamide (PubChem CID 165421318) has the molecular formula C19H23N5O3S and a molecular weight of 401.49 g/mol. Its IUPAC name is N-[[(1S,5S,6R,7R)-3-[2-(methylamino)-1,3-thiazole-4-carbonyl]-10-oxa-3-azatricyclo[5.2.1.01,5]decan-6-yl]methyl]-1H-pyrrole-3-carboxamide.
| Compound Name | N-[[(1S,5S,6R,7R)-3-[2-(methylamino)-1,3-thiazole-4-carbonyl]-10-oxa-3-azatricyclo[5.2.1.01,5]decan-6-yl]methyl]-1H-pyrrole-3-carboxamide |
|---|---|
| PubChem CID | 165421318 |
| Molecular Formula | C19H23N5O3S |
| Molecular Weight | 401.49 g/mol |
| Exact Mass | 401.15 |
| IUPAC Name | N-[[(1S,5S,6R,7R)-3-[2-(methylamino)-1,3-thiazole-4-carbonyl]-10-oxa-3-azatricyclo[5.2.1.01,5]decan-6-yl]methyl]-1H-pyrrole-3-carboxamide |
| SMILES | CNc1nc(C(=O)N2C[C@@H]3[C@H](CNC(=O)c4cc[nH]c4)[C@H]4CC[C@]3(C2)O4)cs1 |
| InChI | InChI=1S/C19H23N5O3S/c1-20-18-23-14(9-28-18)17(26)24-8-13-12(15-2-4-19(13,10-24)27-15)7-22-16(25)11-3-5-21-6-11/h3,5-6,9,12-13,15,21H,2,4,7-8,10H2,1H3,(H,20,23)(H,22,25)/t12-,13+,15+,19+/m0/s1 |
| InChIKey | DLTPLKLHHAWIGD-FAYLSGKYSA-N |
| XLogP | 1.56 |
| TPSA | 99.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.49 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |