C15H23F3N2O2 — CID 154820317
1-[(1S,5S,6R,7R)-6-[(dimethylamino)methyl]-10-oxa-3-azatricyclo[5.2.1.01,5]decan-3-yl]-4,4,4-trifluorobutan-1-one (PubChem CID 154820317) has the molecular formula C15H23F3N2O2 and a molecular weight of 320.36 g/mol. Its IUPAC name is 1-[(1S,5S,6R,7R)-6-[(dimethylamino)methyl]-10-oxa-3-azatricyclo[5.2.1.01,5]decan-3-yl]-4,4,4-trifluorobutan-1-one.
| Compound Name | 1-[(1S,5S,6R,7R)-6-[(dimethylamino)methyl]-10-oxa-3-azatricyclo[5.2.1.01,5]decan-3-yl]-4,4,4-trifluorobutan-1-one |
|---|---|
| PubChem CID | 154820317 |
| Molecular Formula | C15H23F3N2O2 |
| Molecular Weight | 320.36 g/mol |
| Exact Mass | 320.17 |
| IUPAC Name | 1-[(1S,5S,6R,7R)-6-[(dimethylamino)methyl]-10-oxa-3-azatricyclo[5.2.1.01,5]decan-3-yl]-4,4,4-trifluorobutan-1-one |
| SMILES | CN(C)C[C@H]1[C@H]2CN(C(=O)CCC(F)(F)F)C[C@]23CC[C@H]1O3 |
| InChI | InChI=1S/C15H23F3N2O2/c1-19(2)7-10-11-8-20(13(21)4-6-15(16,17)18)9-14(11)5-3-12(10)22-14/h10-12H,3-9H2,1-2H3/t10-,11+,12+,14+/m0/s1 |
| InChIKey | YVXHBTKLKDWHQW-FMCLSXCISA-N |
| XLogP | 1.90 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.36 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |